| Catalog | OFC15453879 |
| CAS | 15453-87-9 |
| Category | Fluorinated Metal Complexes |
| Synonyms | Indium,Tris(1,1,1-Trifluoro-2,4-Pentanedionato-Ko,Ko')-(9ci) |
| Purity | >98% |
| MDL Number | MFCD00058830 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | (Z)-4-bis[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]oxy]indiganyloxy-1,1,1-trifluoropent-3-en-2-one |
| InChI | InChI=1S/3C5H5F3O2.In/c3*1-3(9)2-4(10)5(6,7)8;/h3*2,9H,1H3;/q;;;+3/p-3/b3*3-2-; |
| InChI Key | JSFSIUKMFCYGBL-IQMQLBNYSA-K |
| Isomeric SMILES | C/C(=C/C(=O)C(F)(F)F)/O[In](O/C(=C\C(=O)C(F)(F)F)/C)O/C(=C\C(=O)C(F)(F)F)/C |
| Molecular Formula | C15H12F9InO6 |
| Molecular Weight | 574.05 |
| Storage | Inert atmosphere, 2-8 °C |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 15 |
| Rotatable Bond Count | 9 |
| Exact Mass | 573.9528953 g/mol |
| Monoisotopic Mass | 573.9528953 g/mol |
| Topological Polar Surface Area | 78.9Ų |
| Heavy Atom Count | 31 |
| Formal Charge | 0 |
| Complexity | 686 |
Please kindly note that our products and services are for research use only.