| Catalog | OFC239463946 |
| CAS | 239463-94-6 |
| Category | Fluorinated Cyclic Ethers |
| Synonyms | [2,3,3,4,4,4-Hexafluoro-2-(trifluoromethyl)butyl]oxirane |
| Purity | 97% |
| MDL Number | MFCD00155856 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-[2,3,3,4,4,4-hexafluoro-2-(trifluoromethyl)butyl]oxirane |
| InChI | InChI=1S/C7H5F9O/c8-4(6(11,12)13,1-3-2-17-3)5(9,10)7(14,15)16/h3H,1-2H2 |
| InChI Key | SYBLPUZYAVFTTM-UHFFFAOYSA-N |
| Isomeric SMILES | C1C(O1)CC(C(C(F)(F)F)(F)F)(C(F)(F)F)F |
| Molecular Formula | C7H5F9O |
| Molecular Weight | 276.10 |
| XLogP3-AA | 3.4 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 10 |
| Rotatable Bond Count | 3 |
| Exact Mass | 276.01966824 g/mol |
| Monoisotopic Mass | 276.01966824 g/mol |
| Topological Polar Surface Area | 12.5Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 293 |
Please kindly note that our products and services are for research use only.