| Catalog | OFC1016515891 |
| CAS | 1016515-89-1 |
| Category | Fluorinated Quinolines |
| Purity | 95% |
| MDL Number | MFCD09814964 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 6-fluoroquinoline-8-sulfonyl chloride |
| InChI | InChI=1S/C9H5ClFNO2S/c10-15(13,14)8-5-7(11)4-6-2-1-3-12-9(6)8/h1-5H |
| InChI Key | NBZCFXPRLZWBPM-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC2=CC(=CC(=C2N=C1)S(=O)(=O)Cl)F |
| Molecular Formula | C9H5ClFNO2S |
| Molecular Weight | 245.66 |
| Storage | Inert atmosphere, room temperature |
| XLogP3-AA | 2.3 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 244.9713554 g/mol |
| Monoisotopic Mass | 244.9713554 g/mol |
| Topological Polar Surface Area | 55.4Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 330 |
Please kindly note that our products and services are for research use only.