
| Catalog | OFC396305 |
| CAS | 396-30-5 |
| Category | Fluorinated Quinolines |
| Synonyms | Quinoline, 6-fluoro- |
| Purity | >98.0%(GC) |
| MDL Number | MFCD01685512 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 6-fluoroquinoline |
| InChI | InChI=1S/C9H6FN/c10-8-3-4-9-7(6-8)2-1-5-11-9/h1-6H |
| InChI Key | RMDCSDVIVXJELQ-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC2=C(C=CC(=C2)F)N=C1 |
| EC Number | 685-586-1 |
| Reaxys Registry Number | 112962 |
| Molecular Formula | C9H6FN |
| Molecular Weight | 147.15 |
| Boiling Point | 126 °C (30 mmHg) |
| Flash Point | 98 °C |
| Refractive Index | 1.59 |
| Appearance | Light yellow to brown clear liquid |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 147.048427358 g/mol |
| Monoisotopic Mass | 147.048427358 g/mol |
| Topological Polar Surface Area | 12.9Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 138 |
| HS Number | 2933.49.7000 |
Please kindly note that our products and services are for research use only.