
| Catalog | OFC21873507 |
| CAS | 21873-50-7 |
| Category | Fluorinated Quinolines |
| Synonyms | 6-Fluoro-4-hydroxyquinoline |
| Purity | >95% |
| MDL Number | MFCD00269610 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 6-fluoro-1H-quinolin-4-one |
| InChI | InChI=1S/C9H6FNO/c10-6-1-2-8-7(5-6)9(12)3-4-11-8/h1-5H,(H,11,12) |
| InChI Key | BYZXOYSEYWCLOK-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC2=C(C=C1F)C(=O)C=CN2 |
| EC Number | 670-764-3 |
| Molecular Formula | C9H6FNO |
| Molecular Weight | 163.15 |
| Storage | Sealed in dry, 2-8 °C |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 163.043341977 g/mol |
| Monoisotopic Mass | 163.043341977 g/mol |
| Topological Polar Surface Area | 29.1Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 227 |
Please kindly note that our products and services are for research use only.