| Catalog | OFC217661999 |
| CAS | 217661-99-9 |
| Category | Fluorinated Pyrimidines |
| Synonyms | 1-(4-fluorophenyl)-2-(2-methylsulfanylpyrimidin-4-yl)ethanone |
| Purity | 95% |
| MDL Number | MFCD18157689 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 1-(4-fluorophenyl)-2-(2-methylsulfanylpyrimidin-4-yl)ethanone |
| InChI | InChI=1S/C13H11FN2OS/c1-18-13-15-7-6-11(16-13)8-12(17)9-2-4-10(14)5-3-9/h2-7H,8H2,1H3 |
| InChI Key | PQFVLCBGDSDMHY-UHFFFAOYSA-N |
| Isomeric SMILES | CSC1=NC=CC(=N1)CC(=O)C2=CC=C(C=C2)F |
| Molecular Formula | C13H11FN2OS |
| Molecular Weight | 262.30 |
| Storage | Sealed in dry, room temperature |
| XLogP3-AA | 2.5 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Exact Mass | 262.05761231 g/mol |
| Monoisotopic Mass | 262.05761231 g/mol |
| Topological Polar Surface Area | 68.2Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 282 |
Please kindly note that our products and services are for research use only.