| Catalog | OFC154093579 |
| CAS | 154093-57-9 |
| Category | Trifluoromethylation Agents |
| Purity | 97% |
| MDL Number | MFCD02683571 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | (4-fluorophenyl)-diphenylsulfanium;trifluoromethanesulfonate |
| InChI | InChI=1S/C18H14FS.CHF3O3S/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;2-1(3,4)8(5,6)7/h1-14H;(H,5,6,7)/q+1;/p-1 |
| InChI Key | SGYQZOQILXLBIB-UHFFFAOYSA-M |
| Isomeric SMILES | C1=CC=C(C=C1)[S+](C2=CC=CC=C2)C3=CC=C(C=C3)F.C(F)(F)(F)S(=O)(=O)[O-] |
| EC Number | 622-843-9 |
| Molecular Formula | C19H14F4O3S2 |
| Molecular Weight | 430.44 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 3 |
| Exact Mass | 430.03204930 g/mol |
| Monoisotopic Mass | 430.03204930 g/mol |
| Topological Polar Surface Area | 66.6Ų |
| Heavy Atom Count | 28 |
| Formal Charge | 0 |
| Complexity | 400 |
Please kindly note that our products and services are for research use only.