
| Catalog | OFC399519 |
| CAS | 399-51-9 |
| Category | Fluorinated Indoles |
| Synonyms | 1H-indole, 6-fluoro- |
| Purity | >98.0%(GC) |
| MDL Number | MFCD00056933 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 6-fluoro-1H-indole |
| InChI | InChI=1S/C8H6FN/c9-7-2-1-6-3-4-10-8(6)5-7/h1-5,10H |
| InChI Key | YYFFEPUCAKVRJX-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC(=CC2=C1C=CN2)F |
| EC Number | 700-113-1 |
| Molecular Formula | C8H6FN |
| Molecular Weight | 135.14 |
| Melting Point | 75.0-78.0 °C |
| Appearance | White to light yellow to light orange powder to crystal |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 135.048427358 g/mol |
| Monoisotopic Mass | 135.048427358 g/mol |
| Topological Polar Surface Area | 15.8Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 126 |
| HS Number | 2933.99.8290 |
Please kindly note that our products and services are for research use only.