
| Catalog | OFC3093978-1 |
| CAS | 3093-97-8 |
| Category | Fluorinated Indoles |
| Synonyms | 6-Fluoro-1H-indole-2-carboxylic acid |
| Purity | >98.0%(T)(HPLC) |
| MDL Number | MFCD01863162 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 6-fluoro-1H-indole-2-carboxylic acid |
| InChI | InChI=1S/C9H6FNO2/c10-6-2-1-5-3-8(9(12)13)11-7(5)4-6/h1-4,11H,(H,12,13) |
| InChI Key | LRTIKMXIKAOCDM-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC2=C(C=C1F)NC(=C2)C(=O)O |
| EC Number | 815-842-1 |
| Molecular Formula | C9H6FNO2 |
| Molecular Weight | 179.15 |
| Melting Point | 250 °C(dec.) |
| Appearance | Light yellow to yellow to orange powder to crystal |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 179.03825660 g/mol |
| Monoisotopic Mass | 179.03825660 g/mol |
| Topological Polar Surface Area | 53.1Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 222 |
Please kindly note that our products and services are for research use only.