| Catalog | OFC2022857 |
| CAS | 2022-85-7 |
| Category | Fluorinated Pyrimidines |
| Synonyms | 4-Amino-5-fluoro-2-hydroxypyrimidine; Flucytosine |
| Purity | >98.0%(T)(HPLC) |
| MDL Number | MFCD00006035 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 6-amino-5-fluoro-1H-pyrimidin-2-one |
| InChI | InChI=1S/C4H4FN3O/c5-2-1-7-4(9)8-3(2)6/h1H,(H3,6,7,8,9) |
| InChI Key | XRECTZIEBJDKEO-UHFFFAOYSA-N |
| Isomeric SMILES | C1=NC(=O)NC(=C1F)N |
| EC Number | 217-968-7 |
| Reaxys Registry Number | 3604562 |
| Molecular Formula | C4H4FN3O |
| Molecular Weight | 129.09 |
| Appearance | White to almost white powder to crystal |
| Solubility | Solubility in water |
| XLogP3-AA | -0.9 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 129.03383992 g/mol |
| Monoisotopic Mass | 129.03383992 g/mol |
| Topological Polar Surface Area | 67.5Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 208 |
| HS Number | 2933.59.9500 |
Please kindly note that our products and services are for research use only.