| Catalog | OFC155168 |
| CAS | 155-16-8 |
| Category | Fluorinated Pyrimidines |
| Synonyms | 1-Methyl-5-fluorouracil |
| Purity | 97% |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 5-fluoro-1-methylpyrimidine-2,4-dione |
| InChI | InChI=1S/C5H5FN2O2/c1-8-2-3(6)4(9)7-5(8)10/h2H,1H3,(H,7,9,10) |
| InChI Key | PPCVYQHUOMISIG-UHFFFAOYSA-N |
| Isomeric SMILES | CN1C=C(C(=O)NC1=O)F |
| Molecular Formula | C5H5FN2O2 |
| Molecular Weight | 144.11 |
| XLogP3-AA | -0.5 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 144.03350557 g/mol |
| Monoisotopic Mass | 144.03350557 g/mol |
| Topological Polar Surface Area | 49.4Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 224 |
Please kindly note that our products and services are for research use only.