| Catalog | OFC58086672-2 |
| CAS | 58086-67-2 |
| Category | Nucleophilic Fluorination Agents |
| Synonyms | 2-Fluoro-1-Methylpyridin-1-Ium 4-Methylbenzenesulfonate |
| Purity | >98.0%(T) |
| MDL Number | MFCD00011983 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-fluoro-1-methylpyridin-1-ium;4-methylbenzenesulfonate |
| InChI | InChI=1S/C7H8O3S.C6H7FN/c1-6-2-4-7(5-3-6)11(8,9)10;1-8-5-3-2-4-6(8)7/h2-5H,1H3,(H,8,9,10);2-5H,1H3/q;+1/p-1 |
| InChI Key | HQWDKLAIDBOLFE-UHFFFAOYSA-M |
| Isomeric SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+]1=CC=CC=C1F |
| EC Number | 261-108-3 |
| Reaxys Registry Number | 4345357 |
| Molecular Formula | C13H14FNO3S |
| Molecular Weight | 283.32 |
| Melting Point | 132 °C |
| Appearance | White to almost white powder to crystal |
| Solubility | Soluble in water |
| Storage | Store under inert gas |
| Stability | Moisture sensitive |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 283.06784264 g/mol |
| Monoisotopic Mass | 283.06784264 g/mol |
| Topological Polar Surface Area | 69.5Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 268 |
Please kindly note that our products and services are for research use only.