| Catalog | OFC1480962-3 |
| CAS | 1480-96-2 |
| Category | Fluorinated Pyrimidines |
| Synonyms | 2-Methoxy-5-fluorouracil |
| Purity | >98.0%(GC)(T) |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 5-fluoro-2-methoxy-1H-pyrimidin-6-one |
| InChI | InChI=1S/C5H5FN2O2/c1-10-5-7-2-3(6)4(9)8-5/h2H,1H3,(H,7,8,9) |
| InChI Key | VMIFBCPINLZNNI-UHFFFAOYSA-N |
| Isomeric SMILES | COC1=NC=C(C(=O)N1)F |
| EC Number | 473-810-9 |
| Reaxys Registry Number | 134775 |
| Molecular Formula | C5H5FN2O2 |
| Molecular Weight | 144.11 |
| Melting Point | 199.0-203.0 °C |
| Appearance | White to almost white powder to crystal |
| XLogP3-AA | 0 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 144.03350557 g/mol |
| Monoisotopic Mass | 144.03350557 g/mol |
| Topological Polar Surface Area | 50.7Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 222 |
| HS Number | 2933.59.9500 |
Please kindly note that our products and services are for research use only.