
| Catalog | OFC1842144 |
| CAS | 1842-14-4 |
| Category | Fluorinated Benzimidazoles |
| Purity | 97% |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 1-ethyl-5,6-difluoro-2-methylbenzimidazole |
| InChI | InChI=1S/C10H10F2N2/c1-3-14-6(2)13-9-4-7(11)8(12)5-10(9)14/h4-5H,3H2,1-2H3 |
| InChI Key | QCUMUJRSDPQTIG-UHFFFAOYSA-N |
| Isomeric SMILES | CCN1C(=NC2=CC(=C(C=C21)F)F)C |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 |
| XLogP3-AA | 2.3 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 196.08120465 g/mol |
| Monoisotopic Mass | 196.08120465 g/mol |
| Topological Polar Surface Area | 17.8Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 212 |
Please kindly note that our products and services are for research use only.