| Catalog | OFC647824564 |
| CAS | 647824-56-4 |
| Category | Fluorinated Thiophenes |
| Synonyms | (2E)-2-(dimethylaminomethylidene)-4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione |
| MDL Number | MFCD00120342 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | (2E)-2-(dimethylaminomethylidene)-4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione |
| InChI | InChI=1S/C11H10F3NO2S/c1-15(2)6-7(10(17)11(12,13)14)9(16)8-4-3-5-18-8/h3-6H,1-2H3/b7-6- |
| InChI Key | HMKYPMUUZCJODN-SREVYHEPSA-N |
| Isomeric SMILES | CN(C)/C=C(/C(=O)C1=CC=CS1)\C(=O)C(F)(F)F |
| Molecular Formula | C11H10F3NO2S |
| Molecular Weight | 277.26 |
| XLogP3-AA | 3 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 4 |
| Exact Mass | 277.03843422 g/mol |
| Monoisotopic Mass | 277.03843422 g/mol |
| Topological Polar Surface Area | 65.6Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 377 |
Please kindly note that our products and services are for research use only.