| Catalog | OFC1823252829 |
| CAS | 1823252-82-9 |
| Category | Fluorinated Thiophenes |
| Purity | 97% |
| MDL Number | MFCD28119009 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 7,7-difluoro-5-thia-2-azaspiro[3.4]octane |
| InChI | InChI=1S/C6H9F2NS/c7-6(8)1-5(10-4-6)2-9-3-5/h9H,1-4H2 |
| InChI Key | AWOFXEXDGHVZET-UHFFFAOYSA-N |
| Isomeric SMILES | C1C2(CNC2)SCC1(F)F |
| Molecular Formula | C6H9F2NS |
| Molecular Weight | 165.20 |
| XLogP3-AA | 0.9 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 165.04237679 g/mol |
| Monoisotopic Mass | 165.04237679 g/mol |
| Topological Polar Surface Area | 37.3Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 156 |
Please kindly note that our products and services are for research use only.