| Catalog | OFC2379918508 |
| CAS | 2379918-50-8 |
| Category | Fluorinated Pyrimidines |
| MDL Number | MFCD31812110 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 4,5-dichloro-2-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]-6-methylpyrimidine |
| InChI | InChI=1S/C11H5Cl3F3N3/c1-4-7(13)9(14)20-10(19-4)8-6(12)2-5(3-18-8)11(15,16)17/h2-3H,1H3 |
| InChI Key | LINMJKWSOBRDMN-UHFFFAOYSA-N |
| Isomeric SMILES | CC1=C(C(=NC(=N1)C2=C(C=C(C=N2)C(F)(F)F)Cl)Cl)Cl |
| Molecular Formula | C11H5Cl3F3N3 |
| Molecular Weight | 342.53 |
| XLogP3-AA | 4.3 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 1 |
| Exact Mass | 340.950115 g/mol |
| Monoisotopic Mass | 340.950115 g/mol |
| Topological Polar Surface Area | 38.7Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 345 |
Please kindly note that our products and services are for research use only.