| Catalog | OFC2263969 |
| CAS | 2263-96-9 |
| Category | Fluorinated Pyrimidines |
| Synonyms | 2,4-Pyrimidinediamine, 5-(4-chlorophenyl)-6-(trifluoromethyl)- |
| Purity | 97% |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 5-(4-chlorophenyl)-6-(trifluoromethyl)pyrimidine-2,4-diamine |
| InChI | InChI=1S/C11H8ClF3N4/c12-6-3-1-5(2-4-6)7-8(11(13,14)15)18-10(17)19-9(7)16/h1-4H,(H4,16,17,18,19) |
| InChI Key | BOMKEFCBQZPVAF-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC(=CC=C1C2=C(N=C(N=C2N)N)C(F)(F)F)Cl |
| Molecular Formula | C11H8ClF3N4 |
| Molecular Weight | 288.66 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 1 |
| Exact Mass | 288.0389585 g/mol |
| Monoisotopic Mass | 288.0389585 g/mol |
| Topological Polar Surface Area | 77.8Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 307 |
Please kindly note that our products and services are for research use only.