
| Catalog | OFC697836 |
| CAS | 697-83-6 |
| Category | Fluorinated Pyrimidines |
| Synonyms | Pyrimidine, 5-chloro-2,4,6-trifluoro- |
| Purity | >98.0%(GC) |
| MDL Number | MFCD00191933 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 5-chloro-2,4,6-trifluoropyrimidine |
| InChI | InChI=1S/C4ClF3N2/c5-1-2(6)9-4(8)10-3(1)7 |
| InChI Key | GOYNRDSJTYLXBU-UHFFFAOYSA-N |
| Isomeric SMILES | C1(=C(N=C(N=C1F)F)F)Cl |
| EC Number | 211-807-4 |
| Reaxys Registry Number | 610168 |
| Molecular Formula | C4ClF3N2 |
| Molecular Weight | 168.50 |
| Boiling Point | 115 °C |
| Refractive Index | 1.44 |
| Appearance | Colorless to light yellow clear liquid |
| XLogP3-AA | 2.1 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Exact Mass | 167.9702102 g/mol |
| Monoisotopic Mass | 167.9702102 g/mol |
| Topological Polar Surface Area | 25.8Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 113 |
Please kindly note that our products and services are for research use only.