| Catalog | OFC1912445965 |
| CAS | 1912445-96-5 |
| Category | Fluorinated Indoles |
| Purity | 98% |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 4-bromo-5-fluoro-2,3-dimethyl-1H-indole-7-carboxylic acid |
| InChI | InChI=1S/C11H9BrFNO2/c1-4-5(2)14-10-6(11(15)16)3-7(13)9(12)8(4)10/h3,14H,1-2H3,(H,15,16) |
| InChI Key | ZWCNWPFSOARSPO-UHFFFAOYSA-N |
| Isomeric SMILES | CC1=C(NC2=C1C(=C(C=C2C(=O)O)F)Br)C |
| Molecular Formula | C11H9BrFNO2 |
| Molecular Weight | 286.10 |
| Storage | Sealed in dry, room temperature |
| XLogP3-AA | 3.1 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 284.98007 g/mol |
| Monoisotopic Mass | 284.98007 g/mol |
| Topological Polar Surface Area | 53.1Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 302 |
Please kindly note that our products and services are for research use only.