| Catalog | OFC683274524 | 
| CAS | 683274-52-4 | 
| Category | Fluorinated Quinolines | 
| MDL Number | MFCD03407379 | 
※ Please kindly note that our products are for research use only.
| IUPAC Name | 3-bromo-4-chloro-2-(trifluoromethyl)quinoline | 
| InChI | InChI=1S/C10H4BrClF3N/c11-7-8(12)5-3-1-2-4-6(5)16-9(7)10(13,14)15/h1-4H | 
| InChI Key | NIZYLEKJSBTGJS-UHFFFAOYSA-N | 
| Isomeric SMILES | C1=CC=C2C(=C1)C(=C(C(=N2)C(F)(F)F)Br)Cl | 
| EC Number | 673-059-9 | 
| Molecular Formula | C10H4BrClF3N | 
| Molecular Weight | 310.50 | 
| XLogP3-AA | 4.4 | 
| Hydrogen Bond Donor Count | 0 | 
| Hydrogen Bond Acceptor Count | 4 | 
| Rotatable Bond Count | 0 | 
| Exact Mass | 308.91677 g/mol | 
| Monoisotopic Mass | 308.91677 g/mol | 
| Topological Polar Surface Area | 12.9Ų | 
| Heavy Atom Count | 16 | 
| Formal Charge | 0 | 
| Complexity | 261 | 
Please kindly note that our products and services are for research use only.