| Catalog | OFC14353889-3 |
| CAS | 14353-88-9 |
| Category | Trifluoromethylation Agents |
| Synonyms | Pentafluoro[bis(trifluoroacetoxy)iodo]benzene; FPIFA |
| Purity | >97.0%(T) |
| MDL Number | MFCD00191612 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | [(2,3,4,5,6-pentafluorophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate |
| InChI | InChI=1S/C10F11IO4/c11-1-2(12)4(14)6(5(15)3(1)13)22(25-7(23)9(16,17)18)26-8(24)10(19,20)21 |
| InChI Key | OQWAXRPJEPTTSZ-UHFFFAOYSA-N |
| Isomeric SMILES | C1(=C(C(=C(C(=C1F)F)I(OC(=O)C(F)(F)F)OC(=O)C(F)(F)F)F)F)F |
| Canonical SMILES | O=C(C(F)(F)F)O[I](c1c(F)c(F)c(c(c1F)F)F)OC(=O)C(F)(F)F |
| EC Number | 623-272-8 |
| Reaxys Registry Number | 2030069 |
| Molecular Formula | C10F11IO4 |
| Molecular Weight | 519.99 |
| Melting Point | 118.0-122.0 °C |
| Appearance | White to almost white powder to crystal |
| Solubility | Soluble in methanol |
| Storage | Store under inert gas |
| Stability | Light sensitive, Air sensitive |
| XLogP3-AA | 5.5 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 15 |
| Rotatable Bond Count | 5 |
| Exact Mass | 519.86657 g/mol |
| Monoisotopic Mass | 519.86657 g/mol |
| Topological Polar Surface Area | 52.6Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 494 |
| HS Number | 2917.39.7000 |
Please kindly note that our products and services are for research use only.