| Catalog | OFC14949690 |
| CAS | 14949-69-0 |
| Category | Fluorinated Metal Complexes |
| Synonyms | Bis(1,1,1,5,5,5-Hexafluoropentane-2,4-Dionato-O,O')Nickel |
| Purity | 98% |
| MDL Number | MFCD00067506 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate;nickel(2+) |
| InChI | InChI=1S/2C5H2F6O2.Ni/c2*6-4(7,8)2(12)1-3(13)5(9,10)11;/h2*1,12H;/q;;+2/p-2/b2*2-1-; |
| InChI Key | YBMAWNCLJNNCMV-PAMPIZDHSA-L |
| Isomeric SMILES | C(=C(\[O-])/C(F)(F)F)\C(=O)C(F)(F)F.C(=C(\[O-])/C(F)(F)F)\C(=O)C(F)(F)F.[Ni+2] |
| EC Number | 239-028-5 |
| Molecular Formula | C10H2F12NiO4 |
| Molecular Weight | 472.79 |
| Storage | Inert atmosphere, room temperature |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 16 |
| Rotatable Bond Count | 2 |
| Exact Mass | 471.911488 g/mol |
| Monoisotopic Mass | 471.911488 g/mol |
| Topological Polar Surface Area | 80.3Ų |
| Heavy Atom Count | 27 |
| Formal Charge | 0 |
| Complexity | 210 |
Please kindly note that our products and services are for research use only.