| Catalog | OFC951776242 |
| CAS | 951776-24-2 |
| Category | Fluorinated Metal Complexes |
| Purity | >95.00% |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-2-ide;bis(trifluoromethylsulfonyl)azanide;gold |
| InChI | InChI=1S/C27H37N2.C2F6NO4S2.Au/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/h9-21H,1-8H3;;/q2*-1; |
| InChI Key | SRNIVRFMRMHJTC-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)N2[CH-]N(C=C2)C3=C(C=CC=C3C(C)C)C(C)C.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Au] |
| EC Number | 694-801-8 |
| Molecular Formula | C29H36AuF6N3O4S2 |
| Molecular Weight | 865.7 |
| Appearance | White to pale yellow solid |
| Stability | Air sensitive |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 14 |
| Rotatable Bond Count | 8 |
| Exact Mass | 866.179538 g/mol |
| Monoisotopic Mass | 866.179538 g/mol |
| Topological Polar Surface Area | 92.5Ų |
| Heavy Atom Count | 45 |
| Formal Charge | -2 |
| Complexity | 1050 |
Please kindly note that our products and services are for research use only.