| Catalog | OFC216016318 |
| CAS | 216016-31-8 |
| Category | Fluorinated Pyrimidines |
| Synonyms | 2-amino-3-methyl-6-(trifluoromethyl)-4(3H)-pyrimidinone |
| Purity | tech |
| MDL Number | MFCD01936471 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-amino-3-methyl-6-(trifluoromethyl)pyrimidin-4-one |
| InChI | InChI=1S/C6H6F3N3O/c1-12-4(13)2-3(6(7,8)9)11-5(12)10/h2H,1H3,(H2,10,11) |
| InChI Key | HILJAKYDYCKBTC-UHFFFAOYSA-N |
| Isomeric SMILES | CN1C(=O)C=C(N=C1N)C(F)(F)F |
| Molecular Formula | C6H6F3N3O |
| Molecular Weight | 193.13 |
| XLogP3-AA | -0.2 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Exact Mass | 193.04629631 g/mol |
| Monoisotopic Mass | 193.04629631 g/mol |
| Topological Polar Surface Area | 58.7Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 305 |
Please kindly note that our products and services are for research use only.