| Catalog | OFC134356733 |
| CAS | 134356-73-3 |
| Category | Fluorinated Cyclic Ethers |
| Synonyms | (R)-(-)-4-Fluorostyrene oxide |
| Purity | >98% |
| MDL Number | MFCD03788740 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | (2R)-2-(4-fluorophenyl)oxirane |
| InChI | InChI=1S/C8H7FO/c9-7-3-1-6(2-4-7)8-5-10-8/h1-4,8H,5H2/t8-/m0/s1 |
| InChI Key | ICVNPQMUUHPPOK-QMMMGPOBSA-N |
| Isomeric SMILES | C1[C@H](O1)C2=CC=C(C=C2)F |
| EC Number | 622-827-1 |
| Molecular Formula | C8H7FO |
| Molecular Weight | 138.14 |
| Boiling Point | 92 °C |
| Density | 1.17 g/cm3 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 138.048093005 g/mol |
| Monoisotopic Mass | 138.048093005 g/mol |
| Topological Polar Surface Area | 12.5Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 118 |
Please kindly note that our products and services are for research use only.