| Catalog | OFC1765920 |
| CAS | 1765-92-0 |
| Category | Fluorinated Cyclic Ethers |
| Synonyms | 4,4,5,5,6,6,6-Heptafluoro-1,2-epoxyhexane |
| Purity | 97% |
| MDL Number | MFCD00155825 |
※ Please kindly note that our products are for research use only.
| IUPAC Name | 2-(2,2,3,3,4,4,4-heptafluorobutyl)oxirane |
| InChI | InChI=1S/C6H5F7O/c7-4(8,1-3-2-14-3)5(9,10)6(11,12)13/h3H,1-2H2 |
| InChI Key | YXNWXQYDINSHJC-UHFFFAOYSA-N |
| Isomeric SMILES | C1C(O1)CC(C(C(F)(F)F)(F)F)(F)F |
| EC Number | 621-556-6 |
| Molecular Formula | C6H5F7O |
| Molecular Weight | 226.09 |
| Boiling Point | 108-109 °C (720 mmHg) |
| XLogP3-AA | 2.7 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 3 |
| Exact Mass | 226.02286191 g/mol |
| Monoisotopic Mass | 226.02286191 g/mol |
| Topological Polar Surface Area | 12.5Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 221 |
Please kindly note that our products and services are for research use only.