What is the molecular formula of the compound described in the reference?
The molecular formula is C13H14N6O.
What are the synonyms for the compound?
The synonyms for the compound are 6-((4-(Aminomethyl)benzyl)oxy)-7H-purin-2-amine, 674799-96-3, O6-[4-(Aminomethyl)benzyl]guanine, and 6-[[4-(aminomethyl)phenyl]methoxy]-7H-purin-2-amine.
What is the molecular weight of the compound?
The molecular weight is 270.29 g/mol.
When was the compound created?
The compound was created on February 16, 2009.
When was the compound last modified?
The compound was last modified on October 21, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 6-[[4-(aminomethyl)phenyl]methoxy]-7H-purin-2-amine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C13H14N6O/c14-5-8-1-3-9(4-2-8)6-20-12-10-11(17-7-16-10)18-13(15)19-12/h1-4,7H,5-6,14H2,(H3,15,16,17,18,19).
What is the InChIKey of the compound?
The InChIKey of the compound is UINSGVKWAFJDPI-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is C1=CC(=CC=C1CN)COC2=NC(=NC3=C2NC=N3)N.
What is the XLogP3 value of the compound?
The XLogP3 value of the compound is 0.1.
※ Please kindly note that our products are for research use only.