What is the molecular formula of O-Acetyl-L-serine?
The molecular formula of O-Acetyl-L-serine is C5H9NO4.
What is the molecular weight of O-Acetyl-L-serine?
The molecular weight of O-Acetyl-L-serine is 147.13 g/mol.
What is the IUPAC name of O-Acetyl-L-serine?
The IUPAC name of O-Acetyl-L-serine is (2S)-3-acetyloxy-2-aminopropanoic acid.
What is the InChI of O-Acetyl-L-serine?
The InChI of O-Acetyl-L-serine is InChI=1S/C5H9NO4/c1-3(7)10-2-4(6)5(8)9/h4H,2,6H2,1H3,(H,8,9)/t4-/m0/s1.
What is the canonical SMILES of O-Acetyl-L-serine?
The canonical SMILES of O-Acetyl-L-serine is CC(=O)OCC(C(=O)O)N.
What is the CAS number of O-Acetyl-L-serine?
The CAS number of O-Acetyl-L-serine is 5147-00-2.
What is the UNII of O-Acetyl-L-serine?
The UNII of O-Acetyl-L-serine is G05L7T7ZEQ.
What is the ChEMBL ID of O-Acetyl-L-serine?
The ChEMBL ID of O-Acetyl-L-serine is CHEMBL1234916.
What is the KEGG ID of O-Acetyl-L-serine?
The KEGG ID of O-Acetyl-L-serine is C00979.
What is the Wikipedia page for O-Acetyl-L-serine?
The Wikipedia page for O-Acetyl-L-serine is "O-Acetylserine".