What is the molecular formula of NSC42165?
The molecular formula of NSC42165 is C12H11N3O6S2.
What is the molecular weight of NSC42165?
The molecular weight of NSC42165 is 357.4 g/mol.
What is the IUPAC name of NSC42165?
The IUPAC name of NSC42165 is 4-[2-(4-sulfophenyl)iminohydrazinyl]benzenesulfonic acid.
What is the InChI of NSC42165?
The InChI of NSC42165 is InChI=1S/C12H11N3O6S2/c16-22(17,18)11-5-1-9(2-6-11)13-15-14-10-3-7-12(8-4-10)23(19,20)21/h1-8H,(H,13,14)(H,16,17,18)(H,19,20,21).
What is the InChIKey of NSC42165?
The InChIKey of NSC42165 is AJMWXYSMAMYAIT-UHFFFAOYSA-N.
What is the canonical SMILES of NSC42165?
The canonical SMILES of NSC42165 is C1=CC(=CC=C1NN=NC2=CC=C(C=C2)S(=O)(=O)O)S(=O)(=O)O.
What is the CAS number of NSC42165?
The CAS number of NSC42165 is 17596-06-4.
What is the XLogP3-AA value of NSC42165?
The XLogP3-AA value of NSC42165 is 1.5.
What is the hydrogen bond donor count of NSC42165?
The hydrogen bond donor count of NSC42165 is 3.
Is NSC42165 a canonicalized compound?
Yes, NSC42165 is a canonicalized compound according to PubChem.