What is the molecular formula of Nonafluoro-1-iodobutane?
The molecular formula is C4F9I.
What is the molecular weight of Nonafluoro-1-iodobutane?
The molecular weight is 345.93 g/mol.
What is the IUPAC name of Nonafluoro-1-iodobutane?
The IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodobutane.
What is the InChI of Nonafluoro-1-iodobutane?
The InChI is InChI=1S/C4F9I/c5-1(6,3(9,10)11)2(7,8)4(12,13)14.
What is the InChIKey of Nonafluoro-1-iodobutane?
The InChIKey is PGRFXXCKHGIFSV-UHFFFAOYSA-N.
What is the canonical SMILES representation of Nonafluoro-1-iodobutane?
The canonical SMILES is C(C(C(F)(F)I)(F)F)(C(F)(F)F)(F)F.
What is the CAS number of Nonafluoro-1-iodobutane?
The CAS number is 423-39-2.
What is the EC number of Nonafluoro-1-iodobutane?
The EC number is 207-025-8.
What is the UNII of Nonafluoro-1-iodobutane?
The UNII is N4357HS8BY.
Is Nonafluoro-1-iodobutane canonicalized?
Yes, it is canonicalized according to PubChem.