What is the PubChem CID of Nomegestrone acetate?
The PubChem CID of Nomegestrone acetate is 91668.
What is the molecular formula of Nomegestrone acetate?
The molecular formula of Nomegestrone acetate is C23H30O4.
What is the molecular weight of Nomegestrone acetate?
The molecular weight of Nomegestrone acetate is 370.5 g/mol.
What are the synonyms of Nomegestrone acetate?
The synonyms of Nomegestrone acetate are Nomegestrol acetate, 58652-20-3, Nomegestrol 17-acetate, TX 066, and NOMAC.
What is the IUPAC name of Nomegestrone acetate?
The IUPAC name of Nomegestrone acetate is [(8S,9S,10R,13S,14S,17R)-17-acetyl-6,13-dimethyl-3-oxo-1,2,8,9,10,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
What is the InChI of Nomegestrone acetate?
The InChI of Nomegestrone acetate is InChI=1S/C23H30O4/c1-13-11-20-18(17-6-5-16(26)12-19(13)17)7-9-22(4)21(20)8-10-23(22,14(2)24)27-15(3)25/h11-12,17-18,20-21H,5-10H2,1-4H3/t17-,18-,20-,21+,22+,23+/m1/s1.
What is the InChIKey of Nomegestrone acetate?
The InChIKey of Nomegestrone acetate is IIVBFTNIGYRNQY-YQLZSBIMSA-N.
What is the canonical SMILES of Nomegestrone acetate?
The canonical SMILES of Nomegestrone acetate is CC1=CC2C(CCC3(C2CCC3(C(=O)C)OC(=O)C)C)C4C1=CC(=O)CC4.
What is the CAS number of Nomegestrone acetate?
The CAS number of Nomegestrone acetate is 58652-20-3.
What is the Common Chemistry ID of Nomegestrone acetate?
The Common Chemistry ID of Nomegestrone acetate is CHEMBL1476022.