What is the molecular formula of Nitroethylene?
The molecular formula of Nitroethylene is C2H3NO2.
What is the molecular weight of Nitroethylene?
The molecular weight of Nitroethylene is 73.05 g/mol.
What is the IUPAC name of Nitroethylene?
The IUPAC name of Nitroethylene is 1-nitroethene.
What is the InChI of Nitroethylene?
The InChI of Nitroethylene is InChI=1S/C2H3NO2/c1-2-3(4)5/h2H,1H2.
What is the InChIKey of Nitroethylene?
The InChIKey of Nitroethylene is RPMXALUWKZHYOV-UHFFFAOYSA-N.
What is the canonical SMILES of Nitroethylene?
The canonical SMILES of Nitroethylene is C=C[N+](=O)[O-].
What is the CAS number of Nitroethylene?
The CAS number of Nitroethylene is 3638-64-0.
What is the EC number of Nitroethylene?
The EC number of Nitroethylene is 687-643-6.
What is the XLogP3-AA value of Nitroethylene?
The XLogP3-AA value of Nitroethylene is 0.7.
Is Nitroethylene a canonicalized compound?
Yes, Nitroethylene is a canonicalized compound according to PubChem.