What is the molecular formula of Nitroacetonitrile?
The molecular formula of Nitroacetonitrile is C2H2N2O2.
What is the molecular weight of Nitroacetonitrile?
The molecular weight of Nitroacetonitrile is 86.05 g/mol.
What is the IUPAC name of Nitroacetonitrile?
The IUPAC name of Nitroacetonitrile is 2-nitroacetonitrile.
What is the InChI of Nitroacetonitrile?
The InChI of Nitroacetonitrile is InChI=1S/C2H2N2O2/c3-1-2-4(5)6/h2H2.
What is the InChIKey of Nitroacetonitrile?
The InChIKey of Nitroacetonitrile is DWBOSISZPCOPFS-UHFFFAOYSA-N.
What is the canonical SMILES of Nitroacetonitrile?
The canonical SMILES of Nitroacetonitrile is C(C#N)[N+](=O)[O-].
What is the DSSTox Substance ID of Nitroacetonitrile?
The DSSTox Substance ID of Nitroacetonitrile is DTXSID40902418.
What is the Nikkaji Number of Nitroacetonitrile?
The Nikkaji Number of Nitroacetonitrile is J416.305B.
What is the XLogP3-AA value of Nitroacetonitrile?
The XLogP3-AA value of Nitroacetonitrile is 0.
Is the compound canonicalized?
Yes, the compound is canonicalized.