What is the molecular formula of Naphthol AS-LT?
The molecular formula of Naphthol AS-LT is C19H17NO3.
What is the molecular weight of Naphthol AS-LT?
The molecular weight of Naphthol AS-LT is 307.3 g/mol.
What is the IUPAC name of Naphthol AS-LT?
The IUPAC name of Naphthol AS-LT is 3-hydroxy-N-(4-methoxy-2-methylphenyl)naphthalene-2-carboxamide.
What is the InChIKey of Naphthol AS-LT?
The InChIKey of Naphthol AS-LT is BPLTYDPIHLNUAR-UHFFFAOYSA-N.
What is the Canonical SMILES of Naphthol AS-LT?
The Canonical SMILES of Naphthol AS-LT is CC1=C(C=CC(=C1)OC)NC(=O)C2=CC3=CC=CC=C3C=C2O.
What is the CAS number of Naphthol AS-LT?
The CAS number of Naphthol AS-LT is 3689-20-1.
What is the European Community (EC) Number of Naphthol AS-LT?
The European Community (EC) Number of Naphthol AS-LT is 222-994-7.
What is the DSSTox Substance ID of Naphthol AS-LT?
The DSSTox Substance ID of Naphthol AS-LT is DTXSID2063137.
What is the XLogP3-AA value of Naphthol AS-LT?
The XLogP3-AA value of Naphthol AS-LT is 4.5.
Is Naphthol AS-LT a canonicalized compound?
Yes, Naphthol AS-LT is a canonicalized compound.
What are the synonyms of NAPHTHOL AS-LT?
The synonyms of NAPHTHOL AS-LT include 3689-20-1, NAPHTHOL AS-LT, 2-Naphthalenecarboxamide, 3-hydroxy-N-(4-methoxy-2-methylphenyl)-, and 3-Hydroxy-4'-methoxy-2'-methyl-2-naphthanilide.
What is the InChI of NAPHTHOL AS-LT?
The InChI of NAPHTHOL AS-LT is InChI=1S/C19H17NO3/c1-12-9-15(23-2)7-8-17(12)20-19(22)16-10-13-5-3-4-6-14(13)11-18(16)21/h3-11,21H,1-2H3,(H,20,22).