What is the molecular formula of Naphtalene-1,3,6-trisulfonic acid?
The molecular formula of Naphtalene-1,3,6-trisulfonic acid is C10H8O9S3.
What is the molecular weight of Naphtalene-1,3,6-trisulfonic acid?
The molecular weight of Naphtalene-1,3,6-trisulfonic acid is 368.4 g/mol.
What are some synonyms for Naphtalene-1,3,6-trisulfonic acid?
Some synonyms for Naphtalene-1,3,6-trisulfonic acid are naphthalene-1,3,6-trisulfonic acid, 1,3,6-Naphthalenetrisulfonic acid, and Naphthalene-1,3,6-trisulphonic acid.
What is the InChI key for Naphtalene-1,3,6-trisulfonic acid?
The InChI key for Naphtalene-1,3,6-trisulfonic acid is ZPBSAMLXSQCSOX-UHFFFAOYSA-N.
What is the canonical SMILES notation for Naphtalene-1,3,6-trisulfonic acid?
The canonical SMILES notation for Naphtalene-1,3,6-trisulfonic acid is C1=CC2=C(C=C(C=C2C=C1S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O.
What is the CAS number for Naphtalene-1,3,6-trisulfonic acid?
The CAS number for Naphtalene-1,3,6-trisulfonic acid is 86-66-8.
What is the hydrogen bond donor count of Naphtalene-1,3,6-trisulfonic acid?
The hydrogen bond donor count of Naphtalene-1,3,6-trisulfonic acid is 3.
What is the hydrogen bond acceptor count of Naphtalene-1,3,6-trisulfonic acid?
The hydrogen bond acceptor count of Naphtalene-1,3,6-trisulfonic acid is 9.
What is the topological polar surface area of Naphtalene-1,3,6-trisulfonic acid?
The topological polar surface area of Naphtalene-1,3,6-trisulfonic acid is 188 Å2.
How many rotatable bond counts does Naphtalene-1,3,6-trisulfonic acid have?
Naphtalene-1,3,6-trisulfonic acid has 3 rotatable bond counts.
※ Please kindly note that our products are for research use only.