What is the PubChem CID of Naftazone?
The PubChem CID of Naftazone is 71688.
What is the molecular formula of Naftazone?
The molecular formula of Naftazone is C11H9N3O2.
What is the molecular weight of Naftazone?
The molecular weight of Naftazone is 215.21 g/mol.
What is the IUPAC name of Naftazone?
The IUPAC name of Naftazone is (1-hydroxynaphthalen-2-yl)iminourea.
What is the InChI of Naftazone?
The InChI of Naftazone is InChI=1S/C11H9N3O2/c12-11(16)14-13-9-6-5-7-3-1-2-4-8(7)10(9)15/h1-6,15H,(H2,12,16).
What is the InChIKey of Naftazone?
The InChIKey of Naftazone is AGSIRJFXAANBMW-UHFFFAOYSA-N.
What is the canonical SMILES of Naftazone?
The canonical SMILES of Naftazone is C1=CC=C2C(=C1)C=CC(=C2O)N=NC(=O)N.
What is the CAS number of Naftazone?
The CAS number of Naftazone is 15687-37-3.
What is the European Community (EC) number of Naftazone?
The European Community (EC) number of Naftazone is 239-785-1.
What is the ChEMBL ID of Naftazone?
The ChEMBL ID of Naftazone is CHEMBL2106794.