What is the molecular formula of N-tert-Butyl-alpha-phenylnitrone?
The molecular formula of N-tert-Butyl-alpha-phenylnitrone is C11H15NO.
What are the synonyms of N-tert-Butyl-alpha-phenylnitrone?
The synonyms of N-tert-Butyl-alpha-phenylnitrone are n-tert-butyl-alpha-phenylnitrone, 3376-24-7, Phenyl-N-tert-butylnitrone, and N-tert-butyl-1-phenylmethanimine oxide.
What is the molecular weight of N-tert-Butyl-alpha-phenylnitrone?
The molecular weight of N-tert-Butyl-alpha-phenylnitrone is 177.24 g/mol.
What is the IUPAC name of N-tert-Butyl-alpha-phenylnitrone?
The IUPAC name of N-tert-Butyl-alpha-phenylnitrone is N-tert-butyl-1-phenylmethanimine oxide.
What is the InChI of N-tert-Butyl-alpha-phenylnitrone?
The InChI of N-tert-Butyl-alpha-phenylnitrone is InChI=1S/C11H15NO/c1-11(2,3)12(13)9-10-7-5-4-6-8-10/h4-9H,1-3H3/b12-9.
What is the InChIKey of N-tert-Butyl-alpha-phenylnitrone?
The InChIKey of N-tert-Butyl-alpha-phenylnitrone is IYSYLWYGCWTJSG-XFXZXTDPSA-N.
What is the canonical SMILES of N-tert-Butyl-alpha-phenylnitrone?
The canonical SMILES of N-tert-Butyl-alpha-phenylnitrone is CC(C)(C)[N+](=CC1=CC=CC=C1)[O-].
How many hydrogen bond donor count does N-tert-Butyl-alpha-phenylnitrone have?
N-tert-Butyl-alpha-phenylnitrone has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does N-tert-Butyl-alpha-phenylnitrone have?
N-tert-Butyl-alpha-phenylnitrone has 1 hydrogen bond acceptor count.
How many rotatable bond count does N-tert-Butyl-alpha-phenylnitrone have?
N-tert-Butyl-alpha-phenylnitrone has 2 rotatable bond count.
※ Please kindly note that our products are for research use only.