What is the PubChem CID of N-Phenylacrylamide?
The PubChem CID of N-Phenylacrylamide is 221792.
What is the molecular formula of N-Phenylacrylamide?
The molecular formula of N-Phenylacrylamide is C9H9NO.
What are the synonyms of N-Phenylacrylamide?
The synonyms of N-Phenylacrylamide are 2210-24-4, N-phenylprop-2-enamide, and 2-Propenamide, N-phenyl-, among others.
What is the molecular weight of N-Phenylacrylamide?
The molecular weight of N-Phenylacrylamide is 147.17 g/mol.
What is the IUPAC name of N-Phenylacrylamide?
The IUPAC name of N-Phenylacrylamide is N-phenylprop-2-enamide.
What is the InChI of N-Phenylacrylamide?
The InChI of N-Phenylacrylamide is InChI=1S/C9H9NO/c1-2-9(11)10-8-6-4-3-5-7-8/h2-7H,1H2,(H,10,11).
What is the InChIKey of N-Phenylacrylamide?
The InChIKey of N-Phenylacrylamide is BPCNEKWROYSOLT-UHFFFAOYSA-N.
What is the canonical SMILES of N-Phenylacrylamide?
The canonical SMILES of N-Phenylacrylamide is C=CC(=O)NC1=CC=CC=C1.
What is the CAS number of N-Phenylacrylamide?
The CAS number of N-Phenylacrylamide is 2210-24-4.
What is the ChEMBL ID of N-Phenylacrylamide?
The ChEMBL ID of N-Phenylacrylamide is CHEMBL2086477.