What is the molecular formula of N-Nitro-L-arginine?
The molecular formula of N-Nitro-L-arginine is C6H13N5O4.
When was N-Nitro-L-arginine created and modified?
N-Nitro-L-arginine was created on June 24, 2005, and modified on December 30, 2023.
What is the IUPAC Name of N-Nitro-L-arginine?
The IUPAC Name of N-Nitro-L-arginine is (2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoic acid.
What is the InChI of N-Nitro-L-arginine?
The InChI of N-Nitro-L-arginine is InChI=1S/C6H13N5O4/c7-4(5(12)13)2-1-3-9-6(8)10-11(14)15/h4H,1-3,7H2,(H,12,13)(H3,8,9,10)/t4-/m0/s1.
What is the Canonical SMILES of N-Nitro-L-arginine?
The Canonical SMILES of N-Nitro-L-arginine is C(CC(C(=O)O)N)CN=C(N)N[N+](=O)[O-].
What is the molecular weight of N-Nitro-L-arginine?
The molecular weight of N-Nitro-L-arginine is 219.20 g/mol.
What is the ChEBI identifier of N-Nitro-L-arginine?
The ChEBI identifier of N-Nitro-L-arginine is H-Arg(NO2)-OH 2149-70-4.
How does N-Nitro-L-arginine inhibit nitric oxide synthase?
N-Nitro-L-arginine inhibits the enzyme nitric oxide synthase, thereby preventing the formation of nitric oxide (NO).
What role does nitric oxide play in tumor progression?
Nitric oxide plays an important role in tumor blood flow and stimulation of angiogenesis, tumor progression, survival, migration, and invasiveness.
What are some potential activities of NG-nitro-L-arginine?
NG-nitro-L-arginine has potential antineoplastic and antiangiogenic activities.