What is the molecular formula of N,N-Ethylenebis(stearamide)?
The molecular formula of N,N-Ethylenebis(stearamide) is C38H76N2O2.
What is the molecular weight of N,N-Ethylenebis(stearamide)?
The molecular weight of N,N-Ethylenebis(stearamide) is 593.0 g/mol.
What is the IUPAC name of N,N-Ethylenebis(stearamide)?
The IUPAC name of N,N-Ethylenebis(stearamide) is N-[2-(octadecanoylamino)ethyl]octadecanamide.
What is the InChI of N,N-Ethylenebis(stearamide)?
The InChI of N,N-Ethylenebis(stearamide) is InChI=1S/C38H76N2O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37(41)39-35-36-40-38(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-36H2,1-2H3,(H,39,41)(H,40,42).
What is the InChIKey of N,N-Ethylenebis(stearamide)?
The InChIKey of N,N-Ethylenebis(stearamide) is RKISUIUJZGSLEV-UHFFFAOYSA-N.
What is the canonical SMILES of N,N-Ethylenebis(stearamide)?
The canonical SMILES of N,N-Ethylenebis(stearamide) is CCCCCCCCCCCCCCCCC(=O)NCCNC(=O)CCCCCCCCCCCCCCCC.
What is the CAS number of N,N-Ethylenebis(stearamide)?
The CAS number of N,N-Ethylenebis(stearamide) is 110-30-5.
What is the EC number of N,N-Ethylenebis(stearamide)?
The European Community (EC) number of N,N-Ethylenebis(stearamide) is 203-755-6.
What is the UNII of N,N-Ethylenebis(stearamide)?
The UNII of N,N-Ethylenebis(stearamide) is 603RP8TB9A.
What is the Wikipedia page of N,N-Ethylenebis(stearamide)?
The Wikipedia page of N,N-Ethylenebis(stearamide) is "Ethylene_bis(stearamide)".
※ Please kindly note that our products are for research use only.