What is the molecular formula of N,N-Dimethyloxamic acid?
The molecular formula of N,N-Dimethyloxamic acid is C4H7NO3.
What is the molecular weight of N,N-Dimethyloxamic acid?
The molecular weight of N,N-Dimethyloxamic acid is 117.10 g/mol.
What is the IUPAC name of N,N-Dimethyloxamic acid?
The IUPAC name of N,N-Dimethyloxamic acid is 2-(dimethylamino)-2-oxoacetic acid.
What is the InChI of N,N-Dimethyloxamic acid?
The InChI of N,N-Dimethyloxamic acid is InChI=1S/C4H7NO3/c1-5(2)3(6)4(7)8/h1-2H3,(H,7,8).
What is the InChIKey of N,N-Dimethyloxamic acid?
The InChIKey of N,N-Dimethyloxamic acid is YKFGLGXRUVEMNF-UHFFFAOYSA-N.
What is the CAS number of N,N-Dimethyloxamic acid?
The CAS number of N,N-Dimethyloxamic acid is 32833-96-8.
What is the XLogP3-AA value of N,N-Dimethyloxamic acid?
The XLogP3-AA value of N,N-Dimethyloxamic acid is -0.3.
How many hydrogen bond donor counts does N,N-Dimethyloxamic acid have?
N,N-Dimethyloxamic acid has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does N,N-Dimethyloxamic acid have?
N,N-Dimethyloxamic acid has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of N,N-Dimethyloxamic acid?
The topological polar surface area of N,N-Dimethyloxamic acid is 57.6Ų.