What is the molecular formula of N,N-Dimethyl-1-phenyl-2-ethanamine hydrochloride?
The molecular formula is C10H16ClN.
What is the molecular weight of N,N-Dimethyl-1-phenyl-2-ethanamine hydrochloride?
The molecular weight is 185.69 g/mol.
What is the IUPAC name of N,N-Dimethyl-1-phenyl-2-ethanamine hydrochloride?
The IUPAC name is N,N-dimethyl-2-phenylethanamine hydrochloride.
What is the InChI of N,N-Dimethyl-1-phenyl-2-ethanamine hydrochloride?
The InChI is InChI=1S/C10H15N.ClH/c1-11(2)9-8-10-6-4-3-5-7-10;/h3-7H,8-9H2,1-2H3;1H.
What is the InChIKey of N,N-Dimethyl-1-phenyl-2-ethanamine hydrochloride?
The InChIKey is OVBRYLBVLSAOAS-UHFFFAOYSA-N.
What is the canonical SMILES of N,N-Dimethyl-1-phenyl-2-ethanamine hydrochloride?
The canonical SMILES is CN(C)CCC1=CC=CC=C1.Cl.
What is the CAS number of N,N-Dimethyl-1-phenyl-2-ethanamine hydrochloride?
The CAS number is 10275-21-5.
What is the related CAS number of N,N-Dimethyl-1-phenyl-2-ethanamine hydrochloride?
The related CAS number is 1126-71-2.
What is the UNII of N,N-Dimethyl-1-phenyl-2-ethanamine hydrochloride?
The UNII is 0B645VB20Y.
Is N,N-Dimethyl-1-phenyl-2-ethanamine hydrochloride a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.