What is the molecular formula of N,N-Diethyl-m-toluidine?
The molecular formula is C11H17N.
What is the molecular weight of N,N-Diethyl-m-toluidine?
The molecular weight is 163.26 g/mol.
What are the synonyms for N,N-Diethyl-m-toluidine?
The synonyms are N,N-Diethyl-3-methylaniline and N,N-Diethyl-3-methylbenzenamine.
What is the IUPAC name of N,N-Diethyl-m-toluidine?
The IUPAC name is N,N-diethyl-3-methylaniline.
What is the InChI of N,N-Diethyl-m-toluidine?
The InChI is InChI=1S/C11H17N/c1-4-12(5-2)11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3.
What is the InChIKey of N,N-Diethyl-m-toluidine?
The InChIKey is CIPVVROJHKLHJI-UHFFFAOYSA-N.
What is the canonical SMILES of N,N-Diethyl-m-toluidine?
The canonical SMILES is CCN(CC)C1=CC=CC(=C1)C.
What is the CAS number of N,N-Diethyl-m-toluidine?
The CAS number is 91-67-8.
Is N,N-Diethyl-m-toluidine a covalently-bonded unit?
Yes, N,N-Diethyl-m-toluidine is a covalently-bonded unit.