N,N-Bis(2-hydroxyethyl)isopropanolamine

• CAS: 6712-98-7
• Catalog Number: ACM6712987
• Category: Polymer/Macromolecule
• Molecular Weight: 163.21
• Molecular Formula: C₇H₁₇NO₃
• Synonyms: 1-[BIS(2-HYDROXYETHYL)AMINO]-2-PROPANOL;1-[N,N-BIS(2-HYDROXYETHYL)AMINO]-2-PROPANOL;N,N-BIS(2-HYDROXYETHYL)ISOPROPANOLAMINE;1-(N,N-bis(2-Hydroxyethyl)amino)propan-2-ol;1-[bis-(2-hydroxy-ethyl)-amino]-propan-2-ol;1-[bis-2-hydroxy-ethyl-amino]-propan-2-ol;2

Custom Q&A

What is the molecular formula of N,N-Bis(2-hydroxyethyl)isopropanolamine?

The molecular formula is C7H17NO3.

What is the molecular weight of N,N-Bis(2-hydroxyethyl)isopropanolamine?

The molecular weight is 163.21 g/mol.

What is the IUPAC name of N,N-Bis(2-hydroxyethyl)isopropanolamine?

The IUPAC name is 1-[bis(2-hydroxyethyl)amino]propan-2-ol.

What is the InChI of N,N-Bis(2-hydroxyethyl)isopropanolamine?

The InChI is InChI=1S/C7H17NO3/c1-7(11)6-8(2-4-9)3-5-10/h7,9-11H,2-6H2,1H3.

What is the InChIKey of N,N-Bis(2-hydroxyethyl)isopropanolamine?

The InChIKey is ZFECCYLNALETDE-UHFFFAOYSA-N.

What is the canonical SMILES representation of N,N-Bis(2-hydroxyethyl)isopropanolamine?

The canonical SMILES is CC(CN(CCO)CCO)O.

What is the CAS number of N,N-Bis(2-hydroxyethyl)isopropanolamine?

The CAS number is 6712-98-7.

What is the EC number of N,N-Bis(2-hydroxyethyl)isopropanolamine?

The EC number is 229-764-5.

What is the hydrogen bond donor count of N,N-Bis(2-hydroxyethyl)isopropanolamine?

The hydrogen bond donor count is 3.

What is the hydrogen bond acceptor count of N,N-Bis(2-hydroxyethyl)isopropanolamine?

The hydrogen bond acceptor count is 4.