What is the molecular formula of N-Methylsalicylamide?
The molecular formula of N-Methylsalicylamide is C8H9NO2.
What is the molecular weight of N-Methylsalicylamide?
The molecular weight of N-Methylsalicylamide is 151.16 g/mol.
What is the IUPAC name of N-Methylsalicylamide?
The IUPAC name of N-Methylsalicylamide is 2-hydroxy-N-methylbenzamide.
What is the InChI of N-Methylsalicylamide?
The InChI of N-Methylsalicylamide is InChI=1S/C8H9NO2/c1-9-8(11)6-4-2-3-5-7(6)10/h2-5,10H,1H3,(H,9,11).
What is the InChIKey of N-Methylsalicylamide?
The InChIKey of N-Methylsalicylamide is BCKXMQIYWWTZDP-UHFFFAOYSA-N.
What is the canonical SMILES of N-Methylsalicylamide?
The canonical SMILES of N-Methylsalicylamide is CNC(=O)C1=CC=CC=C1O.
What is the CAS number of N-Methylsalicylamide?
The CAS number of N-Methylsalicylamide is 1862-88-0.
Is N-Methylsalicylamide listed in the European Community (EC) Number?
Yes, N-Methylsalicylamide is listed with the European Community (EC) Number 833-635-4.
What is the UNII of N-Methylsalicylamide?
The UNII of N-Methylsalicylamide is QCE3HZ1G0G.
Does N-Methylsalicylamide have a defined atom stereocenter count?
No, N-Methylsalicylamide does not have a defined atom stereocenter count.