What is the molecular formula of N-Isopropylmethylamine?
The molecular formula of N-Isopropylmethylamine is C4H11N.
What is the molecular weight of N-Isopropylmethylamine?
The molecular weight of N-Isopropylmethylamine is 73.14 g/mol.
What is the IUPAC name of N-Isopropylmethylamine?
The IUPAC name of N-Isopropylmethylamine is N-methylpropan-2-amine.
What is the InChI of N-Isopropylmethylamine?
The InChI of N-Isopropylmethylamine is InChI=1S/C4H11N/c1-4(2)5-3/h4-5H,1-3H3.
What is the InChIKey of N-Isopropylmethylamine?
The InChIKey of N-Isopropylmethylamine is XHFGWHUWQXTGAT-UHFFFAOYSA-N.
What is the canonical SMILES of N-Isopropylmethylamine?
The canonical SMILES of N-Isopropylmethylamine is CC(C)NC.
What is the CAS number of N-Isopropylmethylamine?
The CAS number of N-Isopropylmethylamine is 4747-21-1.
What is the EC number of N-Isopropylmethylamine?
The EC number of N-Isopropylmethylamine is 225-266-7.
What is the UNII of N-Isopropylmethylamine?
The UNII of N-Isopropylmethylamine is J3OL90426G.
Is N-Isopropylmethylamine a canonicalized compound?
Yes, N-Isopropylmethylamine is a canonicalized compound.