N-Cyclopropyl-2-(methylamino)acetamide

• Catalog Number: ACMA00001365
• Category: Amines
• Molecular Weight: 128.17
• Molecular Formula: C₆H₁₁NO₃
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of N-cyclopropyl-2-(methylamino)acetamide?

The molecular formula is C6H12N2O.

What is the molecular weight of N-cyclopropyl-2-(methylamino)acetamide?

The molecular weight is 128.17 g/mol.

What is the IUPAC name of N-cyclopropyl-2-(methylamino)acetamide?

The IUPAC name is N-cyclopropyl-2-(methylamino)acetamide.

What is the InChI of N-cyclopropyl-2-(methylamino)acetamide?

The InChI is InChI=1S/C6H12N2O/c1-7-4-6(9)8-5-2-3-5/h5,7H,2-4H2,1H3,(H,8,9).

What is the InChIKey of N-cyclopropyl-2-(methylamino)acetamide?

The InChIKey is RTGJBSRHLWCRQV-UHFFFAOYSA-N.

What is the canonical SMILES of N-cyclopropyl-2-(methylamino)acetamide?

The canonical SMILES is CNCC(=O)NC1CC1.

What is the XLogP3-AA value of N-cyclopropyl-2-(methylamino)acetamide?

The XLogP3-AA value is -0.3.

How many hydrogen bond donor counts does N-cyclopropyl-2-(methylamino)acetamide have?

N-cyclopropyl-2-(methylamino)acetamide has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does N-cyclopropyl-2-(methylamino)acetamide have?

N-cyclopropyl-2-(methylamino)acetamide has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does N-cyclopropyl-2-(methylamino)acetamide have?

N-cyclopropyl-2-(methylamino)acetamide has 3 rotatable bond counts.