What is the molecular formula of N-Acetyl-2-oxindole?
The molecular formula of N-Acetyl-2-oxindole is C10H9NO2.
When was N-Acetyl-2-oxindole created in PubChem?
N-Acetyl-2-oxindole was created in PubChem on March 26, 2005.
What is the molecular weight of N-Acetyl-2-oxindole?
The molecular weight of N-Acetyl-2-oxindole is 175.18 g/mol.
What is the IUPAC name of N-Acetyl-2-oxindole?
The IUPAC name of N-Acetyl-2-oxindole is 1-acetyl-3H-indol-2-one.
What is the Canonical SMILES representation of N-Acetyl-2-oxindole?
The Canonical SMILES representation of N-Acetyl-2-oxindole is CC(=O)N1C(=O)CC2=CC=CC=C21.
How many hydrogen bond donor counts does N-Acetyl-2-oxindole have?
N-Acetyl-2-oxindole has 0 hydrogen bond donor counts.
What is the exact mass of N-Acetyl-2-oxindole?
The exact mass of N-Acetyl-2-oxindole is 175.063328530 g/mol.
How many heavy atoms does N-Acetyl-2-oxindole contain?
N-Acetyl-2-oxindole contains 13 heavy atoms.
Does N-Acetyl-2-oxindole have any defined atom stereocenter count?
No, N-Acetyl-2-oxindole does not have any defined atom stereocenter count.
Is the compound of N-Acetyl-2-oxindole canonicalized?
Yes, the compound of N-Acetyl-2-oxindole is canonicalized according to PubChem.