The molecular formula of the compound is C17H13BrN2O4S2.
What are the synonyms for the compound?
The synonyms for the compound are N-(5-bromopyridin-3-yl)-N-(phenylsulfonyl)benzenesulfonamide, N-(Benzenesulfonyl)-N-(5-bromopyridin-3-yl)benzenesulfonamide, DTXSID60745309, and Ethyl2-chloro-1,3-oxazole-5-carboxylate.
What is the molecular weight of the compound?
The molecular weight of the compound is 453.3 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is N-(benzenesulfonyl)-N-(5-bromopyridin-3-yl)benzenesulfonamide.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C17H13BrN2O4S2/c18-14-11-15(13-19-12-14)20(25(21,22)16-7-3-1-4-8-16)26(23,24)17-9-5-2-6-10-17/h1-13H.
What is the InChIKey of the compound?
The InChIKey of the compound is HIFQSGLCAZLODB-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC=C(C=C1)S(=O)(=O)N(C2=CC(=CN=C2)Br)S(=O)(=O)C3=CC=CC=C3.
What is the CAS number of the compound?
The CAS number of the compound is 1192749-74-8.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.